C30H26FN3O2 — CID 3529519
2-cyano-3-[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-N-(4-methylphenyl)prop-2-enamide (PubChem CID 3529519) has the molecular formula C30H26FN3O2 and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-cyano-3-[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-N-(4-methylphenyl)prop-2-enamide.
| Compound Name | 2-cyano-3-[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-N-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3529519 |
| Molecular Formula | C30H26FN3O2 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | 2-cyano-3-[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]-N-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)C(C#N)=Cc2cc(C)n(-c3ccc(OCc4ccc(F)cc4)cc3)c2C)cc1 |
| InChI | InChI=1S/C30H26FN3O2/c1-20-4-10-27(11-5-20)33-30(35)25(18-32)17-24-16-21(2)34(22(24)3)28-12-14-29(15-13-28)36-19-23-6-8-26(31)9-7-23/h4-17H,19H2,1-3H3,(H,33,35) |
| InChIKey | ITUZSKPMKQUKDM-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|