C30H24F3N3O2 — CID 126251451
(Z)-2-cyano-3-[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126251451) has the molecular formula C30H24F3N3O2 and a molecular weight of 515.54 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126251451 |
| Molecular Formula | C30H24F3N3O2 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | (Z)-2-cyano-3-[2,5-dimethyl-1-(4-phenylmethoxyphenyl)pyrrol-3-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)Nc2cccc(C(F)(F)F)c2)c(C)n1-c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H24F3N3O2/c1-20-15-23(16-24(18-34)29(37)35-26-10-6-9-25(17-26)30(31,32)33)21(2)36(20)27-11-13-28(14-12-27)38-19-22-7-4-3-5-8-22/h3-17H,19H2,1-2H3,(H,35,37)/b24-16- |
| InChIKey | QCNVNJCJAPLAHD-JLPGSUDCSA-N |
| XLogP | 7.24 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|