C23H19F3N4O — CID 126243257
(Z)-2-cyano-3-[2,5-dimethyl-1-(5-methyl-2-pyridinyl)pyrrol-3-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126243257) has the molecular formula C23H19F3N4O and a molecular weight of 424.43 g/mol. Its IUPAC name is (Z)-2-cyano-3-[2,5-dimethyl-1-(5-methyl-2-pyridinyl)pyrrol-3-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[2,5-dimethyl-1-(5-methyl-2-pyridinyl)pyrrol-3-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126243257 |
| Molecular Formula | C23H19F3N4O |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | (Z)-2-cyano-3-[2,5-dimethyl-1-(5-methyl-2-pyridinyl)pyrrol-3-yl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1ccc(-n2c(C)cc(/C=C(/C#N)C(=O)Nc3cccc(C(F)(F)F)c3)c2C)nc1 |
| InChI | InChI=1S/C23H19F3N4O/c1-14-7-8-21(28-13-14)30-15(2)9-17(16(30)3)10-18(12-27)22(31)29-20-6-4-5-19(11-20)23(24,25)26/h4-11,13H,1-3H3,(H,29,31)/b18-10- |
| InChIKey | VREYTDNYODIIHM-ZDLGFXPLSA-N |
| XLogP | 5.36 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|