C18H10F6N2O — CID 124661249
(Z)-2-cyano-N-[3-(trifluoromethyl)phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 124661249) has the molecular formula C18H10F6N2O and a molecular weight of 384.28 g/mol. Its IUPAC name is (Z)-2-cyano-N-[3-(trifluoromethyl)phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-[3-(trifluoromethyl)phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 124661249 |
| Molecular Formula | C18H10F6N2O |
| Molecular Weight | 384.28 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | (Z)-2-cyano-N-[3-(trifluoromethyl)phenyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(C(F)(F)F)cc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H10F6N2O/c19-17(20,21)13-6-4-11(5-7-13)8-12(10-25)16(27)26-15-3-1-2-14(9-15)18(22,23)24/h1-9H,(H,26,27)/b12-8- |
| InChIKey | OBRCYEVQVHFRLH-WQLSENKSSA-N |
| XLogP | 5.27 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.28 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|