C24H16F4N2O2 — CID 6129619
(E)-2-cyano-3-[4-[(2-fluorophenyl)methoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 6129619) has the molecular formula C24H16F4N2O2 and a molecular weight of 440.40 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[(2-fluorophenyl)methoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-[(2-fluorophenyl)methoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6129619 |
| Molecular Formula | C24H16F4N2O2 |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | (E)-2-cyano-3-[4-[(2-fluorophenyl)methoxy]phenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(OCc2ccccc2F)cc1)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H16F4N2O2/c25-22-7-2-1-4-17(22)15-32-21-10-8-16(9-11-21)12-18(14-29)23(31)30-20-6-3-5-19(13-20)24(26,27)28/h1-13H,15H2,(H,30,31)/b18-12+ |
| InChIKey | QDLDEIXVIVATEQ-LDADJPATSA-N |
| XLogP | 5.97 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|