C25H21FN2O2 — CID 24542406
(E)-2-cyano-N-(2,6-dimethylphenyl)-3-[4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enamide (PubChem CID 24542406) has the molecular formula C25H21FN2O2 and a molecular weight of 400.45 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,6-dimethylphenyl)-3-[4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,6-dimethylphenyl)-3-[4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24542406 |
| Molecular Formula | C25H21FN2O2 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (E)-2-cyano-N-(2,6-dimethylphenyl)-3-[4-[(2-fluorophenyl)methoxy]phenyl]prop-2-enamide |
| SMILES | Cc1cccc(C)c1NC(=O)/C(C#N)=C/c1ccc(OCc2ccccc2F)cc1 |
| InChI | InChI=1S/C25H21FN2O2/c1-17-6-5-7-18(2)24(17)28-25(29)21(15-27)14-19-10-12-22(13-11-19)30-16-20-8-3-4-9-23(20)26/h3-14H,16H2,1-2H3,(H,28,29)/b21-14+ |
| InChIKey | CRMYOAQGXHOENI-KGENOOAVSA-N |
| XLogP | 5.57 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|