C28H31N3O — CID 126253102
(Z)-3-[1-(4-butylphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide (PubChem CID 126253102) has the molecular formula C28H31N3O and a molecular weight of 425.58 g/mol. Its IUPAC name is (Z)-3-[1-(4-butylphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide.
| Compound Name | (Z)-3-[1-(4-butylphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 126253102 |
| Molecular Formula | C28H31N3O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | (Z)-3-[1-(4-butylphenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-[(1S)-1-phenylethyl]prop-2-enamide |
| SMILES | CCCCc1ccc(-n2c(C)cc(/C=C(/C#N)C(=O)N[C@@H](C)c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C28H31N3O/c1-5-6-10-23-13-15-27(16-14-23)31-20(2)17-25(22(31)4)18-26(19-29)28(32)30-21(3)24-11-8-7-9-12-24/h7-9,11-18,21H,5-6,10H2,1-4H3,(H,30,32)/b26-18-/t21-/m0/s1 |
| InChIKey | LBMUEOWDLLPHFZ-HUBZVCNYSA-N |
| XLogP | 6.22 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|