C21H21N3O5 — CID 126261383
(Z)-2-cyano-3-(3-ethoxy-2-hydroxy-5-nitrophenyl)-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126261383) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3-ethoxy-2-hydroxy-5-nitrophenyl)-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3-ethoxy-2-hydroxy-5-nitrophenyl)-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126261383 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (Z)-2-cyano-3-(3-ethoxy-2-hydroxy-5-nitrophenyl)-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | CCOc1cc([N+](=O)[O-])cc(/C=C(/C#N)C(=O)NCCCc2ccccc2)c1O |
| InChI | InChI=1S/C21H21N3O5/c1-2-29-19-13-18(24(27)28)12-16(20(19)25)11-17(14-22)21(26)23-10-6-9-15-7-4-3-5-8-15/h3-5,7-8,11-13,25H,2,6,9-10H2,1H3,(H,23,26)/b17-11- |
| InChIKey | YKQQMKCVNVJMDK-BOPFTXTBSA-N |
| XLogP | 3.36 |
| TPSA | 125.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|