C25H30N2O2 — CID 126250926
(Z)-2-cyano-3-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126250926) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126250926 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | (Z)-2-cyano-3-(4-ethoxy-2-methyl-5-propan-2-ylphenyl)-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | CCOc1cc(C)c(/C=C(/C#N)C(=O)NCCCc2ccccc2)cc1C(C)C |
| InChI | InChI=1S/C25H30N2O2/c1-5-29-24-14-19(4)21(16-23(24)18(2)3)15-22(17-26)25(28)27-13-9-12-20-10-7-6-8-11-20/h6-8,10-11,14-16,18H,5,9,12-13H2,1-4H3,(H,27,28)/b22-15- |
| InChIKey | ICZXQOPPEDYLDX-JCMHNJIXSA-N |
| XLogP | 5.17 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|