C21H21BrN2O3 — CID 126236232
(Z)-3-(5-bromo-3-ethoxy-2-hydroxyphenyl)-2-cyano-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126236232) has the molecular formula C21H21BrN2O3 and a molecular weight of 429.31 g/mol. Its IUPAC name is (Z)-3-(5-bromo-3-ethoxy-2-hydroxyphenyl)-2-cyano-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-3-(5-bromo-3-ethoxy-2-hydroxyphenyl)-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126236232 |
| Molecular Formula | C21H21BrN2O3 |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | (Z)-3-(5-bromo-3-ethoxy-2-hydroxyphenyl)-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | CCOc1cc(Br)cc(/C=C(/C#N)C(=O)NCCCc2ccccc2)c1O |
| InChI | InChI=1S/C21H21BrN2O3/c1-2-27-19-13-18(22)12-16(20(19)25)11-17(14-23)21(26)24-10-6-9-15-7-4-3-5-8-15/h3-5,7-8,11-13,25H,2,6,9-10H2,1H3,(H,24,26)/b17-11- |
| InChIKey | WOBWBRMZZUVRMO-BOPFTXTBSA-N |
| XLogP | 4.21 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|