C29H27BrFN3O4 — CID 126249491
(Z)-3-[2-bromo-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126249491) has the molecular formula C29H27BrFN3O4 and a molecular weight of 580.45 g/mol. Its IUPAC name is (Z)-3-[2-bromo-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-3-[2-bromo-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126249491 |
| Molecular Formula | C29H27BrFN3O4 |
| Molecular Weight | 580.45 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | (Z)-3-[2-bromo-5-ethoxy-4-[2-(4-fluoroanilino)-2-oxoethoxy]phenyl]-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)NCCCc2ccccc2)c(Br)cc1OCC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C29H27BrFN3O4/c1-2-37-26-16-21(15-22(18-32)29(36)33-14-6-9-20-7-4-3-5-8-20)25(30)17-27(26)38-19-28(35)34-24-12-10-23(31)11-13-24/h3-5,7-8,10-13,15-17H,2,6,9,14,19H2,1H3,(H,33,36)(H,34,35)/b22-15- |
| InChIKey | XHYBRNIRJKVQKP-JCMHNJIXSA-N |
| XLogP | 5.66 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|