C19H16BrClN2O2 — CID 126238297
(Z)-3-(3-bromo-5-chloro-2-hydroxyphenyl)-2-cyano-N-(3-phenylpropyl)prop-2-enamide (PubChem CID 126238297) has the molecular formula C19H16BrClN2O2 and a molecular weight of 419.71 g/mol. Its IUPAC name is (Z)-3-(3-bromo-5-chloro-2-hydroxyphenyl)-2-cyano-N-(3-phenylpropyl)prop-2-enamide.
| Compound Name | (Z)-3-(3-bromo-5-chloro-2-hydroxyphenyl)-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 126238297 |
| Molecular Formula | C19H16BrClN2O2 |
| Molecular Weight | 419.71 g/mol |
| Exact Mass | 418.01 |
| IUPAC Name | (Z)-3-(3-bromo-5-chloro-2-hydroxyphenyl)-2-cyano-N-(3-phenylpropyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cc(Cl)cc(Br)c1O)C(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C19H16BrClN2O2/c20-17-11-16(21)10-14(18(17)24)9-15(12-22)19(25)23-8-4-7-13-5-2-1-3-6-13/h1-3,5-6,9-11,24H,4,7-8H2,(H,23,25)/b15-9- |
| InChIKey | OASLCFPZLFZEKE-DHDCSXOGSA-N |
| XLogP | 4.46 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.71 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|