C24H18BrFN2O3 — CID 16510274
[2-(4-fluorophenyl)-2-oxoethyl] (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate (PubChem CID 16510274) has the molecular formula C24H18BrFN2O3 and a molecular weight of 481.32 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 16510274 |
| Molecular Formula | C24H18BrFN2O3 |
| Molecular Weight | 481.32 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] (E)-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)OCC(=O)c2ccc(F)cc2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H18BrFN2O3/c1-15-11-18(16(2)28(15)22-9-5-20(25)6-10-22)12-19(13-27)24(30)31-14-23(29)17-3-7-21(26)8-4-17/h3-12H,14H2,1-2H3/b19-12+ |
| InChIKey | KCWAYZOHNJGNDO-XDHOZWIPSA-N |
| XLogP | 5.33 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.32 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|