C24H21BrN4O5S — CID 4845651
[2-oxo-2-(3-sulfamoylanilino)ethyl] 3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate (PubChem CID 4845651) has the molecular formula C24H21BrN4O5S and a molecular weight of 557.43 g/mol. Its IUPAC name is [2-oxo-2-(3-sulfamoylanilino)ethyl] 3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate.
| Compound Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 4845651 |
| Molecular Formula | C24H21BrN4O5S |
| Molecular Weight | 557.43 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | [2-oxo-2-(3-sulfamoylanilino)ethyl] 3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate |
| SMILES | Cc1cc(C=C(C#N)C(=O)OCC(=O)Nc2cccc(S(N)(=O)=O)c2)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H21BrN4O5S/c1-15-10-17(16(2)29(15)21-8-6-19(25)7-9-21)11-18(13-26)24(31)34-14-23(30)28-20-4-3-5-22(12-20)35(27,32)33/h3-12H,14H2,1-2H3,(H,28,30)(H2,27,32,33) |
| InChIKey | BGGUPIUSBUZEGH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 144.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|