C25H25N5O6 — CID 24674454
[2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-oxoethyl] (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 24674454) has the molecular formula C25H25N5O6 and a molecular weight of 491.50 g/mol. Its IUPAC name is [2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-oxoethyl] (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | [2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-oxoethyl] (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 24674454 |
| Molecular Formula | C25H25N5O6 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.18 |
| IUPAC Name | [2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-oxoethyl] (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | COc1ccc(-n2c(C)cc(/C=C(\C#N)C(=O)OCC(=O)Nc3nc(OC)cc(OC)n3)c2C)cc1 |
| InChI | InChI=1S/C25H25N5O6/c1-15-10-17(16(2)30(15)19-6-8-20(33-3)9-7-19)11-18(13-26)24(32)36-14-21(31)27-25-28-22(34-4)12-23(29-25)35-5/h6-12H,14H2,1-5H3,(H,27,28,29,31)/b18-11+ |
| InChIKey | LYOIEHGXPBWOLB-WOJGMQOQSA-N |
| XLogP | 3.00 |
| TPSA | 137.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|