C25H21FN2O4 — CID 16509964
[2-(4-fluorophenyl)-2-oxoethyl] (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 16509964) has the molecular formula C25H21FN2O4 and a molecular weight of 432.45 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-2-oxoethyl] (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | [2-(4-fluorophenyl)-2-oxoethyl] (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 16509964 |
| Molecular Formula | C25H21FN2O4 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [2-(4-fluorophenyl)-2-oxoethyl] (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | COc1ccc(-n2c(C)cc(/C=C(\C#N)C(=O)OCC(=O)c3ccc(F)cc3)c2C)cc1 |
| InChI | InChI=1S/C25H21FN2O4/c1-16-12-19(17(2)28(16)22-8-10-23(31-3)11-9-22)13-20(14-27)25(30)32-15-24(29)18-4-6-21(26)7-5-18/h4-13H,15H2,1-3H3/b20-13+ |
| InChIKey | OFADRQGMZZJYQU-DEDYPNTBSA-N |
| XLogP | 4.57 |
| TPSA | 81.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|