C21H20Cl2N2O3 — CID 16556370
(2,2-dichlorocyclopropyl)methyl (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 16556370) has the molecular formula C21H20Cl2N2O3 and a molecular weight of 419.31 g/mol. Its IUPAC name is (2,2-dichlorocyclopropyl)methyl (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | (2,2-dichlorocyclopropyl)methyl (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 16556370 |
| Molecular Formula | C21H20Cl2N2O3 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (2,2-dichlorocyclopropyl)methyl (E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | COc1ccc(-n2c(C)cc(/C=C(\C#N)C(=O)OCC3CC3(Cl)Cl)c2C)cc1 |
| InChI | InChI=1S/C21H20Cl2N2O3/c1-13-8-15(14(2)25(13)18-4-6-19(27-3)7-5-18)9-16(11-24)20(26)28-12-17-10-21(17,22)23/h4-9,17H,10,12H2,1-3H3/b16-9+ |
| InChIKey | QXXGDAVKZHPFBX-CXUHLZMHSA-N |
| XLogP | 4.75 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|