C22H24ClN3O3 — CID 4876552
[2-(tert-butylamino)-2-oxoethyl] 3-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate (PubChem CID 4876552) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 3-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate.
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 3-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 4876552 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 3-[1-(3-chlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyanoprop-2-enoate |
| SMILES | Cc1cc(C=C(C#N)C(=O)OCC(=O)NC(C)(C)C)c(C)n1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H24ClN3O3/c1-14-9-16(15(2)26(14)19-8-6-7-18(23)11-19)10-17(12-24)21(28)29-13-20(27)25-22(3,4)5/h6-11H,13H2,1-5H3,(H,25,27) |
| InChIKey | QCGYPMOQJWOCKD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|