C22H15Cl3N2O3S — CID 4833048
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 4833048) has the molecular formula C22H15Cl3N2O3S and a molecular weight of 493.80 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 4833048 |
| Molecular Formula | C22H15Cl3N2O3S |
| Molecular Weight | 493.80 g/mol |
| Exact Mass | 491.99 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] 2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(C=C(C#N)C(=O)OCC(=O)c2ccc(Cl)s2)c(C)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H15Cl3N2O3S/c1-12-8-14(13(2)27(12)17-5-3-4-16(23)21(17)25)9-15(10-26)22(29)30-11-18(28)19-6-7-20(24)31-19/h3-9H,11H2,1-2H3 |
| InChIKey | KRFXXQDCDXIKGS-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.80 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|