C22H21Cl2N7O2 — CID 30823925
[4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl (E)-2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 30823925) has the molecular formula C22H21Cl2N7O2 and a molecular weight of 486.36 g/mol. Its IUPAC name is [4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl (E)-2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | [4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl (E)-2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 30823925 |
| Molecular Formula | C22H21Cl2N7O2 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | [4-amino-6-(dimethylamino)-1,3,5-triazin-2-yl]methyl (E)-2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)OCc2nc(N)nc(N(C)C)n2)c(C)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C22H21Cl2N7O2/c1-12-8-14(13(2)31(12)17-7-5-6-16(23)19(17)24)9-15(10-25)20(32)33-11-18-27-21(26)29-22(28-18)30(3)4/h5-9H,11H2,1-4H3,(H2,26,27,28,29)/b15-9+ |
| InChIKey | OIVDFKFTMNJQGC-OQLLNIDSSA-N |
| XLogP | 3.88 |
| TPSA | 122.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|