C25H18Cl2N2 — CID 124548514
(E)-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-naphthalen-2-ylprop-2-enenitrile (PubChem CID 124548514) has the molecular formula C25H18Cl2N2 and a molecular weight of 417.34 g/mol. Its IUPAC name is (E)-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-naphthalen-2-ylprop-2-enenitrile.
| Compound Name | (E)-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-naphthalen-2-ylprop-2-enenitrile |
|---|---|
| PubChem CID | 124548514 |
| Molecular Formula | C25H18Cl2N2 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (E)-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-naphthalen-2-ylprop-2-enenitrile |
| SMILES | Cc1cc(/C=C(/C#N)c2ccc3ccccc3c2)c(C)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C25H18Cl2N2/c1-16-12-21(17(2)29(16)24-9-5-8-23(26)25(24)27)14-22(15-28)20-11-10-18-6-3-4-7-19(18)13-20/h3-14H,1-2H3/b22-14- |
| InChIKey | INLGHOQTHITHON-HMAPJEAMSA-N |
| XLogP | 7.62 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|