C23H22Cl2N4O4 — CID 46658155
[1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] (E)-2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate (PubChem CID 46658155) has the molecular formula C23H22Cl2N4O4 and a molecular weight of 489.36 g/mol. Its IUPAC name is [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] (E)-2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate.
| Compound Name | [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] (E)-2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 46658155 |
| Molecular Formula | C23H22Cl2N4O4 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] (E)-2-cyano-3-[1-(2,3-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoate |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)OC(C)C(=O)NC(=O)NC2CC2)c(C)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H22Cl2N4O4/c1-12-9-15(13(2)29(12)19-6-4-5-18(24)20(19)25)10-16(11-26)22(31)33-14(3)21(30)28-23(32)27-17-7-8-17/h4-6,9-10,14,17H,7-8H2,1-3H3,(H2,27,28,30,32)/b16-10+ |
| InChIKey | FFZYOMKUEJMGGV-MHWRWJLKSA-N |
| XLogP | 4.23 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|