C12H9Cl2NO2 — CID 6243078
ethyl (E)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enoate (PubChem CID 6243078) has the molecular formula C12H9Cl2NO2 and a molecular weight of 270.12 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6243078 |
| Molecular Formula | C12H9Cl2NO2 |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | ethyl (E)-2-cyano-3-(2,3-dichlorophenyl)prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H9Cl2NO2/c1-2-17-12(16)9(7-15)6-8-4-3-5-10(13)11(8)14/h3-6H,2H2,1H3/b9-6+ |
| InChIKey | SFGTVBIWZLJKOT-RMKNXTFCSA-N |
| XLogP | 3.46 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|