C27H26N2O6 — CID 101074217
ethyl (E)-2-cyano-3-[2-[3-[2-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenoxy]propoxy]phenyl]prop-2-enoate (PubChem CID 101074217) has the molecular formula C27H26N2O6 and a molecular weight of 474.51 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[2-[3-[2-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenoxy]propoxy]phenyl]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[2-[3-[2-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenoxy]propoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 101074217 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | ethyl (E)-2-cyano-3-[2-[3-[2-[(E)-2-cyano-3-ethoxy-3-oxoprop-1-enyl]phenoxy]propoxy]phenyl]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/c1ccccc1OCCCOc1ccccc1/C=C(\C#N)C(=O)OCC |
| InChI | InChI=1S/C27H26N2O6/c1-3-32-26(30)22(18-28)16-20-10-5-7-12-24(20)34-14-9-15-35-25-13-8-6-11-21(25)17-23(19-29)27(31)33-4-2/h5-8,10-13,16-17H,3-4,9,14-15H2,1-2H3/b22-16+,23-17+ |
| InChIKey | IINKUVUYLNATTQ-LKNRODPVSA-N |
| XLogP | 4.47 |
| TPSA | 118.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|