C24H20N2O6 — CID 102013525
(E)-3-[2-[4-[2-[(E)-2-carboxy-2-cyanoethenyl]phenoxy]butoxy]phenyl]-2-cyanoprop-2-enoic acid (PubChem CID 102013525) has the molecular formula C24H20N2O6 and a molecular weight of 432.43 g/mol. Its IUPAC name is (E)-3-[2-[4-[2-[(E)-2-carboxy-2-cyanoethenyl]phenoxy]butoxy]phenyl]-2-cyanoprop-2-enoic acid.
| Compound Name | (E)-3-[2-[4-[2-[(E)-2-carboxy-2-cyanoethenyl]phenoxy]butoxy]phenyl]-2-cyanoprop-2-enoic acid |
|---|---|
| PubChem CID | 102013525 |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | (E)-3-[2-[4-[2-[(E)-2-carboxy-2-cyanoethenyl]phenoxy]butoxy]phenyl]-2-cyanoprop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccccc1OCCCCOc1ccccc1/C=C(\C#N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H20N2O6/c25-15-19(23(27)28)13-17-7-1-3-9-21(17)31-11-5-6-12-32-22-10-4-2-8-18(22)14-20(16-26)24(29)30/h1-4,7-10,13-14H,5-6,11-12H2,(H,27,28)(H,29,30)/b19-13+,20-14+ |
| InChIKey | IEKUHVJKPZDVAV-IWGRKNQJSA-N |
| XLogP | 3.91 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|