C21H18BrN3O2S — CID 124583955
4-[3-[(E)-2-(3-bromophenyl)-2-cyanoethenyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide (PubChem CID 124583955) has the molecular formula C21H18BrN3O2S and a molecular weight of 456.37 g/mol. Its IUPAC name is 4-[3-[(E)-2-(3-bromophenyl)-2-cyanoethenyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide.
| Compound Name | 4-[3-[(E)-2-(3-bromophenyl)-2-cyanoethenyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 124583955 |
| Molecular Formula | C21H18BrN3O2S |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | 4-[3-[(E)-2-(3-bromophenyl)-2-cyanoethenyl]-2,5-dimethylpyrrol-1-yl]benzenesulfonamide |
| SMILES | Cc1cc(/C=C(/C#N)c2cccc(Br)c2)c(C)n1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C21H18BrN3O2S/c1-14-10-17(11-18(13-23)16-4-3-5-19(22)12-16)15(2)25(14)20-6-8-21(9-7-20)28(24,26)27/h3-12H,1-2H3,(H2,24,26,27)/b18-11- |
| InChIKey | BMKJDSKNOKUETJ-WQRHYEAKSA-N |
| XLogP | 4.57 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|