C17H16FN3O — CID 820586
(E)-2-cyano-3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-methylprop-2-enamide (PubChem CID 820586) has the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. Its IUPAC name is (E)-2-cyano-3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-methylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 820586 |
| Molecular Formula | C17H16FN3O |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | (E)-2-cyano-3-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C(C#N)=C/c1cc(C)n(-c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C17H16FN3O/c1-11-8-13(9-14(10-19)17(22)20-3)12(2)21(11)16-6-4-15(18)5-7-16/h4-9H,1-3H3,(H,20,22)/b14-9+ |
| InChIKey | FDMLXZRPAJOOME-NTEUORMPSA-N |
| XLogP | 2.89 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|