C26H27N3O — CID 126011231
(E)-2-cyano-N-(3,4-dimethylphenyl)-3-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide (PubChem CID 126011231) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is (E)-2-cyano-N-(3,4-dimethylphenyl)-3-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3,4-dimethylphenyl)-3-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 126011231 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | (E)-2-cyano-N-(3,4-dimethylphenyl)-3-[1-(3,4-dimethylphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/c2cc(C)n(-c3ccc(C)c(C)c3)c2C)cc1C |
| InChI | InChI=1S/C26H27N3O/c1-16-7-9-24(11-18(16)3)28-26(30)23(15-27)14-22-13-20(5)29(21(22)6)25-10-8-17(2)19(4)12-25/h7-14H,1-6H3,(H,28,30)/b23-14+ |
| InChIKey | AXVGVGUXVJOCIX-OEAKJJBVSA-N |
| XLogP | 5.87 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|