C23H22N4O — CID 7328527
(E)-2-cyano-N-(3,4-dimethylphenyl)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)prop-2-enamide (PubChem CID 7328527) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is (E)-2-cyano-N-(3,4-dimethylphenyl)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(3,4-dimethylphenyl)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7328527 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (E)-2-cyano-N-(3,4-dimethylphenyl)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/c2cc(C)n(-c3cccnc3)c2C)cc1C |
| InChI | InChI=1S/C23H22N4O/c1-15-7-8-21(10-16(15)2)26-23(28)20(13-24)12-19-11-17(3)27(18(19)4)22-6-5-9-25-14-22/h5-12,14H,1-4H3,(H,26,28)/b20-12+ |
| InChIKey | WLQYRRZWPIWMDP-UDWIEESQSA-N |
| XLogP | 4.65 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|