C21H17N3O — CID 21381916
(E)-2-benzoyl-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)prop-2-enenitrile (PubChem CID 21381916) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is (E)-2-benzoyl-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)prop-2-enenitrile.
| Compound Name | (E)-2-benzoyl-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 21381916 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (E)-2-benzoyl-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)c2ccccc2)c(C)n1-c1cccnc1 |
| InChI | InChI=1S/C21H17N3O/c1-15-11-18(16(2)24(15)20-9-6-10-23-14-20)12-19(13-22)21(25)17-7-4-3-5-8-17/h3-12,14H,1-2H3/b19-12+ |
| InChIKey | BKUKJELVATVHIO-XDHOZWIPSA-N |
| XLogP | 4.28 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|