About (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile
(Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile (PubChem CID 1252409) has the molecular formula C20H16FN3
and a molecular weight of 317.37 g/mol. Its IUPAC name is (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile.
Molecular Properties
| Compound Name | (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile |
| PubChem CID | 1252409 |
| Molecular Formula | C20H16FN3 |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)c2cccc(F)c2)c(C)n1-c1cccnc1 |
| InChI | InChI=1S/C20H16FN3/c1-14-9-17(15(2)24(14)20-7-4-8-23-13-20)10-18(12-22)16-5-3-6-19(21)11-16/h3-11,13H,1-2H3/b18-10+ |
| InChIKey | SHQIVXLHSPWONZ-VCHYOVAHSA-N |
| XLogP | 4.69 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile?
The IUPAC name of (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile (CID 1252409) is (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile.
What is the SMILES notation for (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile?
The canonical SMILES for (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile is Cc1cc(/C=C(\C#N)c2cccc(F)c2)c(C)n1-c1cccnc1.
What is the InChIKey of (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile?
The InChIKey is SHQIVXLHSPWONZ-VCHYOVAHSA-N. The full InChI is InChI=1S/C20H16FN3/c1-14-9-17(15(2)24(14)20-7-4-8-23-13-20)10-18(12-22)16-5-3-6-19(21)11-16/h3-11,13H,1-2H3/b18-10+.
What are the key properties of (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile?
(Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile has a molecular weight of 317.37 g/mol, XLogP of 4.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-(2,5-dimethyl-1-pyridin-3-ylpyrrol-3-yl)-2-(3-fluorophenyl)prop-2-enenitrile is sourced from PubChem (CID 1252409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).