C18H12BrCl2NO3 — CID 17375810
methyl (E)-3-[5-bromo-2-[(2,6-dichlorophenyl)methoxy]phenyl]-2-cyanoprop-2-enoate (PubChem CID 17375810) has the molecular formula C18H12BrCl2NO3 and a molecular weight of 441.11 g/mol. Its IUPAC name is methyl (E)-3-[5-bromo-2-[(2,6-dichlorophenyl)methoxy]phenyl]-2-cyanoprop-2-enoate.
| Compound Name | methyl (E)-3-[5-bromo-2-[(2,6-dichlorophenyl)methoxy]phenyl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 17375810 |
| Molecular Formula | C18H12BrCl2NO3 |
| Molecular Weight | 441.11 g/mol |
| Exact Mass | 438.94 |
| IUPAC Name | methyl (E)-3-[5-bromo-2-[(2,6-dichlorophenyl)methoxy]phenyl]-2-cyanoprop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C/c1cc(Br)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H12BrCl2NO3/c1-24-18(23)12(9-22)7-11-8-13(19)5-6-17(11)25-10-14-15(20)3-2-4-16(14)21/h2-8H,10H2,1H3/b12-7+ |
| InChIKey | CAYNAJWTYITITQ-KPKJPENVSA-N |
| XLogP | 5.41 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.11 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|