C16H14BrNO3 — CID 9447272
propan-2-yl (E)-3-(5-bromo-2-prop-2-ynoxyphenyl)-2-cyanoprop-2-enoate (PubChem CID 9447272) has the molecular formula C16H14BrNO3 and a molecular weight of 348.20 g/mol. Its IUPAC name is propan-2-yl (E)-3-(5-bromo-2-prop-2-ynoxyphenyl)-2-cyanoprop-2-enoate.
| Compound Name | propan-2-yl (E)-3-(5-bromo-2-prop-2-ynoxyphenyl)-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 9447272 |
| Molecular Formula | C16H14BrNO3 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | propan-2-yl (E)-3-(5-bromo-2-prop-2-ynoxyphenyl)-2-cyanoprop-2-enoate |
| SMILES | C#CCOc1ccc(Br)cc1/C=C(\C#N)C(=O)OC(C)C |
| InChI | InChI=1S/C16H14BrNO3/c1-4-7-20-15-6-5-14(17)9-12(15)8-13(10-18)16(19)21-11(2)3/h1,5-6,8-9,11H,7H2,2-3H3/b13-8+ |
| InChIKey | GLAICRGWAYGOLP-MDWZMJQESA-N |
| XLogP | 3.32 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|