C22H20BrClN2O2 — CID 17255348
(E)-3-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]-2-cyano-N-cyclopentylprop-2-enamide (PubChem CID 17255348) has the molecular formula C22H20BrClN2O2 and a molecular weight of 459.77 g/mol. Its IUPAC name is (E)-3-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]-2-cyano-N-cyclopentylprop-2-enamide.
| Compound Name | (E)-3-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]-2-cyano-N-cyclopentylprop-2-enamide |
|---|---|
| PubChem CID | 17255348 |
| Molecular Formula | C22H20BrClN2O2 |
| Molecular Weight | 459.77 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | (E)-3-[5-bromo-2-[(2-chlorophenyl)methoxy]phenyl]-2-cyano-N-cyclopentylprop-2-enamide |
| SMILES | N#C/C(=C\c1cc(Br)ccc1OCc1ccccc1Cl)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C22H20BrClN2O2/c23-18-9-10-21(28-14-15-5-1-4-8-20(15)24)16(12-18)11-17(13-25)22(27)26-19-6-2-3-7-19/h1,4-5,8-12,19H,2-3,6-7,14H2,(H,26,27)/b17-11+ |
| InChIKey | WZMFRMXWNUFTDU-GZTJUZNOSA-N |
| XLogP | 5.65 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.77 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|