C24H25ClN2O3 — CID 44808060
(E)-3-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide (PubChem CID 44808060) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is (E)-3-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide.
| Compound Name | (E)-3-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide |
|---|---|
| PubChem CID | 44808060 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (E)-3-[4-[(2-chlorophenyl)methoxy]-3-ethoxyphenyl]-2-cyano-N-cyclopentylprop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)NC2CCCC2)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C24H25ClN2O3/c1-2-29-23-14-17(13-19(15-26)24(28)27-20-8-4-5-9-20)11-12-22(23)30-16-18-7-3-6-10-21(18)25/h3,6-7,10-14,20H,2,4-5,8-9,16H2,1H3,(H,27,28)/b19-13+ |
| InChIKey | MDTIEXSAZQDASA-CPNJWEJPSA-N |
| XLogP | 5.28 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|