C28H28N2O3 — CID 126196687
(Z)-2-cyano-N-cyclopentyl-3-[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 126196687) has the molecular formula C28H28N2O3 and a molecular weight of 440.54 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclopentyl-3-[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclopentyl-3-[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126196687 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (Z)-2-cyano-N-cyclopentyl-3-[3-ethoxy-4-(naphthalen-2-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)NC2CCCC2)ccc1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H28N2O3/c1-2-32-27-17-20(15-24(18-29)28(31)30-25-9-5-6-10-25)12-14-26(27)33-19-21-11-13-22-7-3-4-8-23(22)16-21/h3-4,7-8,11-17,25H,2,5-6,9-10,19H2,1H3,(H,30,31)/b24-15- |
| InChIKey | NPOCQBMLQDESBZ-IWIPYMOSSA-N |
| XLogP | 5.78 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|