C18H22N2O3 — CID 6085512
(E)-2-cyano-N-cyclopropyl-3-(3-ethoxy-4-propoxyphenyl)prop-2-enamide (PubChem CID 6085512) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is (E)-2-cyano-N-cyclopropyl-3-(3-ethoxy-4-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-cyclopropyl-3-(3-ethoxy-4-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6085512 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (E)-2-cyano-N-cyclopropyl-3-(3-ethoxy-4-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccc(/C=C(\C#N)C(=O)NC2CC2)cc1OCC |
| InChI | InChI=1S/C18H22N2O3/c1-3-9-23-16-8-5-13(11-17(16)22-4-2)10-14(12-19)18(21)20-15-6-7-15/h5,8,10-11,15H,3-4,6-7,9H2,1-2H3,(H,20,21)/b14-10+ |
| InChIKey | SWQIQLVOKWWFGA-GXDHUFHOSA-N |
| XLogP | 3.06 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|