C27H26N2O2 — CID 6014897
(E)-2-cyano-N-cyclohexyl-3-[2-(naphthalen-1-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 6014897) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is (E)-2-cyano-N-cyclohexyl-3-[2-(naphthalen-1-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-cyclohexyl-3-[2-(naphthalen-1-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6014897 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (E)-2-cyano-N-cyclohexyl-3-[2-(naphthalen-1-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccccc1OCc1cccc2ccccc12)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C27H26N2O2/c28-18-23(27(30)29-24-13-2-1-3-14-24)17-21-10-5-7-16-26(21)31-19-22-12-8-11-20-9-4-6-15-25(20)22/h4-12,15-17,24H,1-3,13-14,19H2,(H,29,30)/b23-17+ |
| InChIKey | VAVAJVNFNLMGPF-HAVVHWLPSA-N |
| XLogP | 5.77 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|