C15H15FN2O — CID 51322190
(Z)-2-cyano-N-cyclopentyl-3-(2-fluorophenyl)prop-2-enamide (PubChem CID 51322190) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclopentyl-3-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclopentyl-3-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 51322190 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | (Z)-2-cyano-N-cyclopentyl-3-(2-fluorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1ccccc1F)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C15H15FN2O/c16-14-8-4-1-5-11(14)9-12(10-17)15(19)18-13-6-2-3-7-13/h1,4-5,8-9,13H,2-3,6-7H2,(H,18,19)/b12-9- |
| InChIKey | SGJNLFLKUBHJQG-XFXZXTDPSA-N |
| XLogP | 2.79 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|