C13H8ClF3N2O — CID 171316212
3-(3-chloro-2,4,5-trifluorophenyl)-2-cyano-N-cyclopropylprop-2-enamide (PubChem CID 171316212) has the molecular formula C13H8ClF3N2O and a molecular weight of 300.67 g/mol. Its IUPAC name is 3-(3-chloro-2,4,5-trifluorophenyl)-2-cyano-N-cyclopropylprop-2-enamide.
| Compound Name | 3-(3-chloro-2,4,5-trifluorophenyl)-2-cyano-N-cyclopropylprop-2-enamide |
|---|---|
| PubChem CID | 171316212 |
| Molecular Formula | C13H8ClF3N2O |
| Molecular Weight | 300.67 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 3-(3-chloro-2,4,5-trifluorophenyl)-2-cyano-N-cyclopropylprop-2-enamide |
| SMILES | N#CC(=Cc1cc(F)c(F)c(Cl)c1F)C(=O)NC1CC1 |
| InChI | InChI=1S/C13H8ClF3N2O/c14-10-11(16)6(4-9(15)12(10)17)3-7(5-18)13(20)19-8-1-2-8/h3-4,8H,1-2H2,(H,19,20) |
| InChIKey | UQYTWLDRZYYYMY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.67 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|