C14H12N2O3 — CID 57397719
3-[(E)-2-cyano-3-(cyclopropylamino)-3-oxoprop-1-enyl]benzoic acid (PubChem CID 57397719) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-[(E)-2-cyano-3-(cyclopropylamino)-3-oxoprop-1-enyl]benzoic acid.
| Compound Name | 3-[(E)-2-cyano-3-(cyclopropylamino)-3-oxoprop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 57397719 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-[(E)-2-cyano-3-(cyclopropylamino)-3-oxoprop-1-enyl]benzoic acid |
| SMILES | N#C/C(=C\c1cccc(C(=O)O)c1)C(=O)NC1CC1 |
| InChI | InChI=1S/C14H12N2O3/c15-8-11(13(17)16-12-4-5-12)7-9-2-1-3-10(6-9)14(18)19/h1-3,6-7,12H,4-5H2,(H,16,17)(H,18,19)/b11-7+ |
| InChIKey | UZZQTXIRPAMLHM-YRNVUSSQSA-N |
| XLogP | 1.57 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|