C17H17F3N2O — CID 4050122
2-cyano-N-cyclohexyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 4050122) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is 2-cyano-N-cyclohexyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | 2-cyano-N-cyclohexyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4050122 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-cyano-N-cyclohexyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#CC(=Cc1cccc(C(F)(F)F)c1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H17F3N2O/c18-17(19,20)14-6-4-5-12(10-14)9-13(11-21)16(23)22-15-7-2-1-3-8-15/h4-6,9-10,15H,1-3,7-8H2,(H,22,23) |
| InChIKey | NNHNADUMIZXULM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|