C13H10F2N2O — CID 8865669
(E)-2-cyano-N-cyclopropyl-3-(3,4-difluorophenyl)prop-2-enamide (PubChem CID 8865669) has the molecular formula C13H10F2N2O and a molecular weight of 248.23 g/mol. Its IUPAC name is (E)-2-cyano-N-cyclopropyl-3-(3,4-difluorophenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-cyclopropyl-3-(3,4-difluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8865669 |
| Molecular Formula | C13H10F2N2O |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (E)-2-cyano-N-cyclopropyl-3-(3,4-difluorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(F)c(F)c1)C(=O)NC1CC1 |
| InChI | InChI=1S/C13H10F2N2O/c14-11-4-1-8(6-12(11)15)5-9(7-16)13(18)17-10-2-3-10/h1,4-6,10H,2-3H2,(H,17,18)/b9-5+ |
| InChIKey | UFVVKSCGYGFHCP-WEVVVXLNSA-N |
| XLogP | 2.15 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|