C16H8F3NO — CID 9338136
(E)-3-(3,4-difluorophenyl)-2-(4-fluorobenzoyl)prop-2-enenitrile (PubChem CID 9338136) has the molecular formula C16H8F3NO and a molecular weight of 287.24 g/mol. Its IUPAC name is (E)-3-(3,4-difluorophenyl)-2-(4-fluorobenzoyl)prop-2-enenitrile.
| Compound Name | (E)-3-(3,4-difluorophenyl)-2-(4-fluorobenzoyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9338136 |
| Molecular Formula | C16H8F3NO |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (E)-3-(3,4-difluorophenyl)-2-(4-fluorobenzoyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(F)c(F)c1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H8F3NO/c17-13-4-2-11(3-5-13)16(21)12(9-20)7-10-1-6-14(18)15(19)8-10/h1-8H/b12-7+ |
| InChIKey | OWLZDRQSDLWJAQ-KPKJPENVSA-N |
| XLogP | 3.89 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|