C19H14F2N2O3 — CID 27129880
ethyl 4-[[(E)-2-cyano-3-(3,4-difluorophenyl)prop-2-enoyl]amino]benzoate (PubChem CID 27129880) has the molecular formula C19H14F2N2O3 and a molecular weight of 356.33 g/mol. Its IUPAC name is ethyl 4-[[(E)-2-cyano-3-(3,4-difluorophenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 4-[[(E)-2-cyano-3-(3,4-difluorophenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 27129880 |
| Molecular Formula | C19H14F2N2O3 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | ethyl 4-[[(E)-2-cyano-3-(3,4-difluorophenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)/C(C#N)=C/c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H14F2N2O3/c1-2-26-19(25)13-4-6-15(7-5-13)23-18(24)14(11-22)9-12-3-8-16(20)17(21)10-12/h3-10H,2H2,1H3,(H,23,24)/b14-9+ |
| InChIKey | QGVONLRLMUCTFL-NTEUORMPSA-N |
| XLogP | 3.69 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|