C24H22N4O4 — CID 155490716
ethyl 4-[[2-cyano-3-[4-(2,3-dimethyl-5-oxopyrazol-1-yl)phenyl]prop-2-enoyl]amino]benzoate (PubChem CID 155490716) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is ethyl 4-[[2-cyano-3-[4-(2,3-dimethyl-5-oxopyrazol-1-yl)phenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-cyano-3-[4-(2,3-dimethyl-5-oxopyrazol-1-yl)phenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 155490716 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | ethyl 4-[[2-cyano-3-[4-(2,3-dimethyl-5-oxopyrazol-1-yl)phenyl]prop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C#N)=Cc2ccc(-n3c(=O)cc(C)n3C)cc2)cc1 |
| InChI | InChI=1S/C24H22N4O4/c1-4-32-24(31)18-7-9-20(10-8-18)26-23(30)19(15-25)14-17-5-11-21(12-6-17)28-22(29)13-16(2)27(28)3/h5-14H,4H2,1-3H3,(H,26,30) |
| InChIKey | PIQFUPIWKQFIPL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|