C17H12F2N2O — CID 8862623
(E)-2-cyano-3-(3,4-difluorophenyl)-N-(3-methylphenyl)prop-2-enamide (PubChem CID 8862623) has the molecular formula C17H12F2N2O and a molecular weight of 298.29 g/mol. Its IUPAC name is (E)-2-cyano-3-(3,4-difluorophenyl)-N-(3-methylphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-(3,4-difluorophenyl)-N-(3-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8862623 |
| Molecular Formula | C17H12F2N2O |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (E)-2-cyano-3-(3,4-difluorophenyl)-N-(3-methylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C/c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C17H12F2N2O/c1-11-3-2-4-14(7-11)21-17(22)13(10-20)8-12-5-6-15(18)16(19)9-12/h2-9H,1H3,(H,21,22)/b13-8+ |
| InChIKey | KDAZFJAGYAEHEF-MDWZMJQESA-N |
| XLogP | 3.82 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|