C10H4F2N2 — CID 786126
2-[(3,4-difluorophenyl)methylidene]propanedinitrile (PubChem CID 786126) has the molecular formula C10H4F2N2 and a molecular weight of 190.15 g/mol. Its IUPAC name is 2-[(3,4-difluorophenyl)methylidene]propanedinitrile.
| Compound Name | 2-[(3,4-difluorophenyl)methylidene]propanedinitrile |
|---|---|
| PubChem CID | 786126 |
| Molecular Formula | C10H4F2N2 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 2-[(3,4-difluorophenyl)methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H4F2N2/c11-9-2-1-7(4-10(9)12)3-8(5-13)6-14/h1-4H |
| InChIKey | SVFZPZAJGPBFRS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|