C18H6N6 — CID 100969781
2-[[3,5-bis(2,2-dicyanoethenyl)phenyl]methylidene]propanedinitrile (PubChem CID 100969781) has the molecular formula C18H6N6 and a molecular weight of 306.29 g/mol. Its IUPAC name is 2-[[3,5-bis(2,2-dicyanoethenyl)phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[3,5-bis(2,2-dicyanoethenyl)phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 100969781 |
| Molecular Formula | C18H6N6 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-[[3,5-bis(2,2-dicyanoethenyl)phenyl]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=Cc1cc(C=C(C#N)C#N)cc(C=C(C#N)C#N)c1 |
| InChI | InChI=1S/C18H6N6/c19-7-16(8-20)4-13-1-14(5-17(9-21)10-22)3-15(2-13)6-18(11-23)12-24/h1-6H |
| InChIKey | JVXXEKBZOXWKMG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 142.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|