C10H7BN2O2 — CID 55255339
[4-(2,2-dicyanoethenyl)phenyl]boronic acid (PubChem CID 55255339) has the molecular formula C10H7BN2O2 and a molecular weight of 197.99 g/mol. Its IUPAC name is [4-(2,2-dicyanoethenyl)phenyl]boronic acid.
| Compound Name | [4-(2,2-dicyanoethenyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 55255339 |
| Molecular Formula | C10H7BN2O2 |
| Molecular Weight | 197.99 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | [4-(2,2-dicyanoethenyl)phenyl]boronic acid |
| SMILES | N#CC(C#N)=Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C10H7BN2O2/c12-6-9(7-13)5-8-1-3-10(4-2-8)11(14)15/h1-5,14-15H |
| InChIKey | HIORQOGDIZGPNJ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.99 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|